About acetic acid;trimethylsilane
acetic acid;trimethylsilane (PubChem CID 158099392) has the molecular formula C5H14O2Si
and a molecular weight of 134.25 g/mol. Its IUPAC name is acetic acid;trimethylsilane.
Molecular Properties
| Compound Name | acetic acid;trimethylsilane |
| PubChem CID | 158099392 |
| Molecular Formula | C5H14O2Si |
| Molecular Weight | 134.25 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | acetic acid;trimethylsilane |
| SMILES | CC(=O)O.C[SiH](C)C |
| InChI | InChI=1S/C3H10Si.C2H4O2/c1-4(2)3;1-2(3)4/h4H,1-3H3;1H3,(H,3,4) |
| InChIKey | USBOVWFSCSDDKB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;trimethylsilane?
The IUPAC name of acetic acid;trimethylsilane (CID 158099392) is acetic acid;trimethylsilane.
What is the SMILES notation for acetic acid;trimethylsilane?
The canonical SMILES for acetic acid;trimethylsilane is CC(=O)O.C[SiH](C)C.
What is the InChIKey of acetic acid;trimethylsilane?
The InChIKey is USBOVWFSCSDDKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10Si.C2H4O2/c1-4(2)3;1-2(3)4/h4H,1-3H3;1H3,(H,3,4).
What are the key properties of acetic acid;trimethylsilane?
acetic acid;trimethylsilane has a molecular weight of 134.25 g/mol, XLogP of 1.19, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;trimethylsilane is sourced from PubChem (CID 158099392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).