About hex-2-enamide;2-methylprop-2-enamide
hex-2-enamide;2-methylprop-2-enamide (PubChem CID 174909220) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is hex-2-enamide;2-methylprop-2-enamide.
Molecular Properties
| Compound Name | hex-2-enamide;2-methylprop-2-enamide |
| PubChem CID | 174909220 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | hex-2-enamide;2-methylprop-2-enamide |
| SMILES | C=C(C)C(N)=O.CCCC=CC(N)=O |
| InChI | InChI=1S/C6H11NO.C4H7NO/c1-2-3-4-5-6(7)8;1-3(2)4(5)6/h4-5H,2-3H2,1H3,(H2,7,8);1H2,2H3,(H2,5,6) |
| InChIKey | ZBSCCQMADBICLH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze hex-2-enamide;2-methylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-2-enamide;2-methylprop-2-enamide?
The IUPAC name of hex-2-enamide;2-methylprop-2-enamide (CID 174909220) is hex-2-enamide;2-methylprop-2-enamide.
What is the SMILES notation for hex-2-enamide;2-methylprop-2-enamide?
The canonical SMILES for hex-2-enamide;2-methylprop-2-enamide is C=C(C)C(N)=O.CCCC=CC(N)=O.
What is the InChIKey of hex-2-enamide;2-methylprop-2-enamide?
The InChIKey is ZBSCCQMADBICLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.C4H7NO/c1-2-3-4-5-6(7)8;1-3(2)4(5)6/h4-5H,2-3H2,1H3,(H2,7,8);1H2,2H3,(H2,5,6).
What are the key properties of hex-2-enamide;2-methylprop-2-enamide?
hex-2-enamide;2-methylprop-2-enamide has a molecular weight of 198.27 g/mol, XLogP of 0.88, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hex-2-enamide;2-methylprop-2-enamide is sourced from PubChem (CID 174909220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).