C8H14 — CID 54310621
2-methylhepta-1,3-diene (PubChem CID 54310621) has the molecular formula C8H14 and a molecular weight of 110.20 g/mol. Its IUPAC name is 2-methylhepta-1,3-diene.
| Compound Name | 2-methylhepta-1,3-diene |
|---|---|
| PubChem CID | 54310621 |
| Molecular Formula | C8H14 |
| Molecular Weight | 110.20 g/mol |
| Exact Mass | 110.11 |
| IUPAC Name | 2-methylhepta-1,3-diene |
| SMILES | C=C(C)C=CCCC |
| InChI | InChI=1S/C8H14/c1-4-5-6-7-8(2)3/h6-7H,2,4-5H2,1,3H3 |
| InChIKey | SKPOBHBERPAXFE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.20 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|