C12H20 — CID 143233879
(3Z)-2,7-dimethylocta-1,3,6-triene;ethene (PubChem CID 143233879) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is (3Z)-2,7-dimethylocta-1,3,6-triene;ethene.
| Compound Name | (3Z)-2,7-dimethylocta-1,3,6-triene;ethene |
|---|---|
| PubChem CID | 143233879 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | (3Z)-2,7-dimethylocta-1,3,6-triene;ethene |
| SMILES | C=C.C=C(C)/C=C\CC=C(C)C |
| InChI | InChI=1S/C10H16.C2H4/c1-9(2)7-5-6-8-10(3)4;1-2/h5,7-8H,1,6H2,2-4H3;1-2H2/b7-5-; |
| InChIKey | WJYLPAJKZXTZQB-YJOCEBFMSA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|