C13H20 — CID 143275541
(3Z,5Z)-2,10-dimethylundeca-1,3,5,9-tetraene (PubChem CID 143275541) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is (3Z,5Z)-2,10-dimethylundeca-1,3,5,9-tetraene.
| Compound Name | (3Z,5Z)-2,10-dimethylundeca-1,3,5,9-tetraene |
|---|---|
| PubChem CID | 143275541 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | (3Z,5Z)-2,10-dimethylundeca-1,3,5,9-tetraene |
| SMILES | C=C(C)/C=C\C=C/CCC=C(C)C |
| InChI | InChI=1S/C13H20/c1-12(2)10-8-6-5-7-9-11-13(3)4/h5-6,8,10-11H,1,7,9H2,2-4H3/b6-5-,10-8- |
| InChIKey | CWNWLHLAJWFTPU-XUTLIFGGSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|