C10H14 — CID 144596669
(3Z,5Z)-2-methylnona-1,3,5,8-tetraene (PubChem CID 144596669) has the molecular formula C10H14 and a molecular weight of 134.22 g/mol. Its IUPAC name is (3Z,5Z)-2-methylnona-1,3,5,8-tetraene.
| Compound Name | (3Z,5Z)-2-methylnona-1,3,5,8-tetraene |
|---|---|
| PubChem CID | 144596669 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | (3Z,5Z)-2-methylnona-1,3,5,8-tetraene |
| SMILES | C=CC/C=C\C=C/C(=C)C |
| InChI | InChI=1S/C10H14/c1-4-5-6-7-8-9-10(2)3/h4,6-9H,1-2,5H2,3H3/b7-6-,9-8- |
| InChIKey | GVXZXVIZVQHDHZ-JPDBVBESSA-N |
| XLogP | 3.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|