About deca-3,6,9-trien-2-one
deca-3,6,9-trien-2-one (PubChem CID 139932510) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is deca-3,6,9-trien-2-one.
Molecular Properties
| Compound Name | deca-3,6,9-trien-2-one |
| PubChem CID | 139932510 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | deca-3,6,9-trien-2-one |
| SMILES | C=CCC=CCC=CC(C)=O |
| InChI | InChI=1S/C10H14O/c1-3-4-5-6-7-8-9-10(2)11/h3,5-6,8-9H,1,4,7H2,2H3 |
| InChIKey | MNCNZVKNCCXDCG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze deca-3,6,9-trien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deca-3,6,9-trien-2-one?
The IUPAC name of deca-3,6,9-trien-2-one (CID 139932510) is deca-3,6,9-trien-2-one.
What is the SMILES notation for deca-3,6,9-trien-2-one?
The canonical SMILES for deca-3,6,9-trien-2-one is C=CCC=CCC=CC(C)=O.
What is the InChIKey of deca-3,6,9-trien-2-one?
The InChIKey is MNCNZVKNCCXDCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O/c1-3-4-5-6-7-8-9-10(2)11/h3,5-6,8-9H,1,4,7H2,2H3.
What are the key properties of deca-3,6,9-trien-2-one?
deca-3,6,9-trien-2-one has a molecular weight of 150.22 g/mol, XLogP of 2.65, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for deca-3,6,9-trien-2-one is sourced from PubChem (CID 139932510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).