C9H16OSi — CID 11126675
(2E)-1-trimethylsilylhexa-2,5-dien-1-one (PubChem CID 11126675) has the molecular formula C9H16OSi and a molecular weight of 168.31 g/mol. Its IUPAC name is (2E)-1-trimethylsilylhexa-2,5-dien-1-one.
| Compound Name | (2E)-1-trimethylsilylhexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 11126675 |
| Molecular Formula | C9H16OSi |
| Molecular Weight | 168.31 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | (2E)-1-trimethylsilylhexa-2,5-dien-1-one |
| SMILES | C=CC/C=C/C(=O)[Si](C)(C)C |
| InChI | InChI=1S/C9H16OSi/c1-5-6-7-8-9(10)11(2,3)4/h5,7-8H,1,6H2,2-4H3/b8-7+ |
| InChIKey | UBAMTSPQZIPTJS-BQYQJAHWSA-N |
| XLogP | 2.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|