About (4E)-10-methyl-6-methylideneundeca-1,4,9-triene
(4E)-10-methyl-6-methylideneundeca-1,4,9-triene (PubChem CID 162518511) has the molecular formula C13H20
and a molecular weight of 176.30 g/mol. Its IUPAC name is (4E)-10-methyl-6-methylideneundeca-1,4,9-triene.
Molecular Properties
| Compound Name | (4E)-10-methyl-6-methylideneundeca-1,4,9-triene |
| PubChem CID | 162518511 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | (4E)-10-methyl-6-methylideneundeca-1,4,9-triene |
| SMILES | C=CC/C=C/C(=C)CCC=C(C)C |
| InChI | InChI=1S/C13H20/c1-5-6-7-10-13(4)11-8-9-12(2)3/h5,7,9-10H,1,4,6,8,11H2,2-3H3/b10-7+ |
| InChIKey | YGNSQJXLTJXVJO-JXMROGBWSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-10-methyl-6-methylideneundeca-1,4,9-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-10-methyl-6-methylideneundeca-1,4,9-triene?
The IUPAC name of (4E)-10-methyl-6-methylideneundeca-1,4,9-triene (CID 162518511) is (4E)-10-methyl-6-methylideneundeca-1,4,9-triene.
What is the SMILES notation for (4E)-10-methyl-6-methylideneundeca-1,4,9-triene?
The canonical SMILES for (4E)-10-methyl-6-methylideneundeca-1,4,9-triene is C=CC/C=C/C(=C)CCC=C(C)C.
What is the InChIKey of (4E)-10-methyl-6-methylideneundeca-1,4,9-triene?
The InChIKey is YGNSQJXLTJXVJO-JXMROGBWSA-N. The full InChI is InChI=1S/C13H20/c1-5-6-7-10-13(4)11-8-9-12(2)3/h5,7,9-10H,1,4,6,8,11H2,2-3H3/b10-7+.
What are the key properties of (4E)-10-methyl-6-methylideneundeca-1,4,9-triene?
(4E)-10-methyl-6-methylideneundeca-1,4,9-triene has a molecular weight of 176.30 g/mol, XLogP of 4.42, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-10-methyl-6-methylideneundeca-1,4,9-triene is sourced from PubChem (CID 162518511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).