C21H36 — CID 161280162
4-ethylidene-8-methylnona-1,7-diene;7-methylocta-1,6-diene (PubChem CID 161280162) has the molecular formula C21H36 and a molecular weight of 288.52 g/mol. Its IUPAC name is 4-ethylidene-8-methylnona-1,7-diene;7-methylocta-1,6-diene.
| Compound Name | 4-ethylidene-8-methylnona-1,7-diene;7-methylocta-1,6-diene |
|---|---|
| PubChem CID | 161280162 |
| Molecular Formula | C21H36 |
| Molecular Weight | 288.52 g/mol |
| Exact Mass | 288.28 |
| IUPAC Name | 4-ethylidene-8-methylnona-1,7-diene;7-methylocta-1,6-diene |
| SMILES | C=CCC(=CC)CCC=C(C)C.C=CCCCC=C(C)C |
| InChI | InChI=1S/C12H20.C9H16/c1-5-8-12(6-2)10-7-9-11(3)4;1-4-5-6-7-8-9(2)3/h5-6,9H,1,7-8,10H2,2-4H3;4,8H,1,5-7H2,2-3H3 |
| InChIKey | VEYXTOVBAKVVRB-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.52 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|