C16H26O — CID 100952257
(2E,6E)-2,10-dimethyl-6-prop-2-enylundeca-2,6,10-trien-1-ol (PubChem CID 100952257) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is (2E,6E)-2,10-dimethyl-6-prop-2-enylundeca-2,6,10-trien-1-ol.
| Compound Name | (2E,6E)-2,10-dimethyl-6-prop-2-enylundeca-2,6,10-trien-1-ol |
|---|---|
| PubChem CID | 100952257 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | (2E,6E)-2,10-dimethyl-6-prop-2-enylundeca-2,6,10-trien-1-ol |
| SMILES | C=CC/C(=C/CCC(=C)C)CC/C=C(\C)CO |
| InChI | InChI=1S/C16H26O/c1-5-8-16(11-6-9-14(2)3)12-7-10-15(4)13-17/h5,10-11,17H,1-2,6-9,12-13H2,3-4H3/b15-10+,16-11- |
| InChIKey | OGRLNHZPLQDJRQ-AXOLISODSA-N |
| XLogP | 4.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|