C10H15N — CID 6441547
(3E)-3,7-dimethylocta-3,7-dienenitrile (PubChem CID 6441547) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is (3E)-3,7-dimethylocta-3,7-dienenitrile.
| Compound Name | (3E)-3,7-dimethylocta-3,7-dienenitrile |
|---|---|
| PubChem CID | 6441547 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | (3E)-3,7-dimethylocta-3,7-dienenitrile |
| SMILES | C=C(C)CC/C=C(\C)CC#N |
| InChI | InChI=1S/C10H15N/c1-9(2)5-4-6-10(3)7-8-11/h6H,1,4-5,7H2,2-3H3/b10-6+ |
| InChIKey | HXWCEYZTTHUVCC-UXBLZVDNSA-N |
| XLogP | 3.20 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|