C41H55N — CID 175971518
(3E,7E,9E,11E,13E,15E,17E,19E,21E,23E,25E,27E)-3,7,11,15,20,24,28,32-octamethyltritriaconta-3,7,9,11,13,15,17,19,21,23,25,27,31-tridecaenenitrile (PubChem CID 175971518) has the molecular formula C41H55N and a molecular weight of 561.90 g/mol. Its IUPAC name is (3E,7E,9E,11E,13E,15E,17E,19E,21E,23E,25E,27E)-3,7,11,15,20,24,28,32-octamethyltritriaconta-3,7,9,11,13,15,17,19,21,23,25,27,31-tridecaenenitrile.
| Compound Name | (3E,7E,9E,11E,13E,15E,17E,19E,21E,23E,25E,27E)-3,7,11,15,20,24,28,32-octamethyltritriaconta-3,7,9,11,13,15,17,19,21,23,25,27,31-tridecaenenitrile |
|---|---|
| PubChem CID | 175971518 |
| Molecular Formula | C41H55N |
| Molecular Weight | 561.90 g/mol |
| Exact Mass | 561.43 |
| IUPAC Name | (3E,7E,9E,11E,13E,15E,17E,19E,21E,23E,25E,27E)-3,7,11,15,20,24,28,32-octamethyltritriaconta-3,7,9,11,13,15,17,19,21,23,25,27,31-tridecaenenitrile |
| SMILES | CC(C)=CCC/C(C)=C/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C=C(\C)CC/C=C(\C)CC#N |
| InChI | InChI=1S/C41H55N/c1-34(2)18-12-21-37(5)24-15-27-38(6)25-13-22-35(3)19-10-11-20-36(4)23-14-26-39(7)28-16-29-40(8)30-17-31-41(9)32-33-42/h10-11,13-16,18-20,22-29,31H,12,17,21,30,32H2,1-9H3/b11-10+,22-13+,23-14+,27-15+,28-16+,35-19+,36-20+,37-24+,38-25+,39-26+,40-29+,41-31+ |
| InChIKey | RLKWJMADFCWWRQ-BURZLKRGSA-N |
| XLogP | 12.83 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.90 |
| LogP ≤ 5 | 12.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|