C18H26O — CID 134820096
(3E,5Z,7Z,9E)-6,10,14-trimethylpentadeca-3,5,7,9,13-pentaen-2-one (PubChem CID 134820096) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is (3E,5Z,7Z,9E)-6,10,14-trimethylpentadeca-3,5,7,9,13-pentaen-2-one.
| Compound Name | (3E,5Z,7Z,9E)-6,10,14-trimethylpentadeca-3,5,7,9,13-pentaen-2-one |
|---|---|
| PubChem CID | 134820096 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | (3E,5Z,7Z,9E)-6,10,14-trimethylpentadeca-3,5,7,9,13-pentaen-2-one |
| SMILES | CC(=O)/C=C/C=C(C)\C=C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C18H26O/c1-15(2)9-6-10-16(3)11-7-12-17(4)13-8-14-18(5)19/h7-9,11-14H,6,10H2,1-5H3/b12-7-,14-8+,16-11+,17-13- |
| InChIKey | WLMRDJQKYYVAJT-RTKOAZCFSA-N |
| XLogP | 5.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|