C23H36O — CID 54479411
6,10,14,18-tetramethylnonadeca-3,5,9,13,17-pentaen-2-one (PubChem CID 54479411) has the molecular formula C23H36O and a molecular weight of 328.54 g/mol. Its IUPAC name is 6,10,14,18-tetramethylnonadeca-3,5,9,13,17-pentaen-2-one.
| Compound Name | 6,10,14,18-tetramethylnonadeca-3,5,9,13,17-pentaen-2-one |
|---|---|
| PubChem CID | 54479411 |
| Molecular Formula | C23H36O |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.28 |
| IUPAC Name | 6,10,14,18-tetramethylnonadeca-3,5,9,13,17-pentaen-2-one |
| SMILES | CC(=O)C=CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C23H36O/c1-19(2)11-7-12-20(3)13-8-14-21(4)15-9-16-22(5)17-10-18-23(6)24/h10-11,13,15,17-18H,7-9,12,14,16H2,1-6H3 |
| InChIKey | XNXYJKYMTPDZRM-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|