C16H26O — CID 54329025
2,8,12-trimethyltrideca-5,7,11-trien-4-one (PubChem CID 54329025) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is 2,8,12-trimethyltrideca-5,7,11-trien-4-one.
| Compound Name | 2,8,12-trimethyltrideca-5,7,11-trien-4-one |
|---|---|
| PubChem CID | 54329025 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 2,8,12-trimethyltrideca-5,7,11-trien-4-one |
| SMILES | CC(C)=CCCC(C)=CC=CC(=O)CC(C)C |
| InChI | InChI=1S/C16H26O/c1-13(2)8-6-9-15(5)10-7-11-16(17)12-14(3)4/h7-8,10-11,14H,6,9,12H2,1-5H3 |
| InChIKey | SXALYJYYGMQJTM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|