C21H34O3 — CID 173093653
carbonic acid;3,7,11,15-tetramethylhexadeca-2,4,6,10,14-pentaene (PubChem CID 173093653) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is carbonic acid;3,7,11,15-tetramethylhexadeca-2,4,6,10,14-pentaene.
| Compound Name | carbonic acid;3,7,11,15-tetramethylhexadeca-2,4,6,10,14-pentaene |
|---|---|
| PubChem CID | 173093653 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | carbonic acid;3,7,11,15-tetramethylhexadeca-2,4,6,10,14-pentaene |
| SMILES | CC=C(C)C=CC=C(C)CCC=C(C)CCC=C(C)C.O=C(O)O |
| InChI | InChI=1S/C20H32.CH2O3/c1-7-18(4)12-9-14-20(6)16-10-15-19(5)13-8-11-17(2)3;2-1(3)4/h7,9,11-12,14-15H,8,10,13,16H2,1-6H3;(H2,2,3,4) |
| InChIKey | DYVIOSBRMIOPLM-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|