C40H62 — CID 163002608
2,6,10,14,19,23,27,30-octamethyldotriaconta-2,6,10,12,14,16,18,22,26,30-decaene (PubChem CID 163002608) has the molecular formula C40H62 and a molecular weight of 542.94 g/mol. Its IUPAC name is 2,6,10,14,19,23,27,30-octamethyldotriaconta-2,6,10,12,14,16,18,22,26,30-decaene.
| Compound Name | 2,6,10,14,19,23,27,30-octamethyldotriaconta-2,6,10,12,14,16,18,22,26,30-decaene |
|---|---|
| PubChem CID | 163002608 |
| Molecular Formula | C40H62 |
| Molecular Weight | 542.94 g/mol |
| Exact Mass | 542.49 |
| IUPAC Name | 2,6,10,14,19,23,27,30-octamethyldotriaconta-2,6,10,12,14,16,18,22,26,30-decaene |
| SMILES | CC=C(C)CCC(C)=CCCC(C)=CCCC(C)=CC=CC=C(C)C=CC=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C40H62/c1-11-34(4)31-32-40(10)30-18-29-39(9)27-16-24-36(6)21-13-12-20-35(5)23-15-26-38(8)28-17-25-37(7)22-14-19-33(2)3/h11-13,15,19-21,23,25-27,30H,14,16-18,22,24,28-29,31-32H2,1-10H3 |
| InChIKey | ZOVKFJZVULUMOX-UHFFFAOYSA-N |
| XLogP | 13.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.94 |
| LogP ≤ 5 | 13.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|