C20H30O — CID 24860841
(2E,4E,6E,8E,10E)-3,7,11,15-tetramethylhexadeca-2,4,6,8,10,14-hexaen-1-ol (PubChem CID 24860841) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E)-3,7,11,15-tetramethylhexadeca-2,4,6,8,10,14-hexaen-1-ol.
| Compound Name | (2E,4E,6E,8E,10E)-3,7,11,15-tetramethylhexadeca-2,4,6,8,10,14-hexaen-1-ol |
|---|---|
| PubChem CID | 24860841 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (2E,4E,6E,8E,10E)-3,7,11,15-tetramethylhexadeca-2,4,6,8,10,14-hexaen-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/C=C/C(C)=C/C=C/C(C)=C/CO |
| InChI | InChI=1S/C20H30O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h7-9,11-15,21H,6,10,16H2,1-5H3/b12-7+,14-8+,18-11+,19-13+,20-15+ |
| InChIKey | DPWGUWZJWIXXSC-OVWFGJEDSA-N |
| XLogP | 5.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|