C39H54O — CID 11993594
(2E,6E,8E,10E,12E,14E,16E,18E,20E,22E,24E,26E)-2,6,10,14,19,23,27,30-octamethylhentriaconta-2,6,8,10,12,14,16,18,20,22,24,26,29-tridecaen-1-ol (PubChem CID 11993594) has the molecular formula C39H54O and a molecular weight of 538.86 g/mol. Its IUPAC name is (2E,6E,8E,10E,12E,14E,16E,18E,20E,22E,24E,26E)-2,6,10,14,19,23,27,30-octamethylhentriaconta-2,6,8,10,12,14,16,18,20,22,24,26,29-tridecaen-1-ol.
| Compound Name | (2E,6E,8E,10E,12E,14E,16E,18E,20E,22E,24E,26E)-2,6,10,14,19,23,27,30-octamethylhentriaconta-2,6,8,10,12,14,16,18,20,22,24,26,29-tridecaen-1-ol |
|---|---|
| PubChem CID | 11993594 |
| Molecular Formula | C39H54O |
| Molecular Weight | 538.86 g/mol |
| Exact Mass | 538.42 |
| IUPAC Name | (2E,6E,8E,10E,12E,14E,16E,18E,20E,22E,24E,26E)-2,6,10,14,19,23,27,30-octamethylhentriaconta-2,6,8,10,12,14,16,18,20,22,24,26,29-tridecaen-1-ol |
| SMILES | CC(C)=CC/C(C)=C/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C=C(\C)CC/C=C(\C)CO |
| InChI | InChI=1S/C39H54O/c1-32(2)29-30-38(8)27-15-25-36(6)22-13-20-34(4)18-11-10-17-33(3)19-12-21-35(5)23-14-24-37(7)26-16-28-39(9)31-40/h10-15,17-25,27-29,40H,16,26,30-31H2,1-9H3/b11-10+,19-12+,20-13+,23-14+,25-15+,33-17+,34-18+,35-21+,36-22+,37-24+,38-27+,39-28+ |
| InChIKey | LNCCVXZCOGEMEN-SJJKFYOOSA-N |
| XLogP | 11.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.86 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|