C45H62 — CID 123174328
2,6,10,14,18,23,27,31,35-nonamethylhexatriaconta-2,6,8,10,12,14,16,18,20,22,24,26,28,30,34-pentadecaene (PubChem CID 123174328) has the molecular formula C45H62 and a molecular weight of 602.99 g/mol. Its IUPAC name is 2,6,10,14,18,23,27,31,35-nonamethylhexatriaconta-2,6,8,10,12,14,16,18,20,22,24,26,28,30,34-pentadecaene.
| Compound Name | 2,6,10,14,18,23,27,31,35-nonamethylhexatriaconta-2,6,8,10,12,14,16,18,20,22,24,26,28,30,34-pentadecaene |
|---|---|
| PubChem CID | 123174328 |
| Molecular Formula | C45H62 |
| Molecular Weight | 602.99 g/mol |
| Exact Mass | 602.49 |
| IUPAC Name | 2,6,10,14,18,23,27,31,35-nonamethylhexatriaconta-2,6,8,10,12,14,16,18,20,22,24,26,28,30,34-pentadecaene |
| SMILES | CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)C=CC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C45H62/c1-37(2)21-14-25-41(7)29-18-33-43(9)31-16-27-39(5)23-12-13-24-40(6)28-17-32-44(10)35-20-36-45(11)34-19-30-42(8)26-15-22-38(3)4/h12-13,16-24,27-36H,14-15,25-26H2,1-11H3 |
| InChIKey | FLXPAPNJWCGFDT-UHFFFAOYSA-N |
| XLogP | 14.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.99 |
| LogP ≤ 5 | 14.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|