C20H30 — CID 123202578
3,7,11,15-tetramethylhexadeca-2,4,6,8,10,14-hexaene (PubChem CID 123202578) has the molecular formula C20H30 and a molecular weight of 270.46 g/mol. Its IUPAC name is 3,7,11,15-tetramethylhexadeca-2,4,6,8,10,14-hexaene.
| Compound Name | 3,7,11,15-tetramethylhexadeca-2,4,6,8,10,14-hexaene |
|---|---|
| PubChem CID | 123202578 |
| Molecular Formula | C20H30 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 3,7,11,15-tetramethylhexadeca-2,4,6,8,10,14-hexaene |
| SMILES | CC=C(C)C=CC=C(C)C=CC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C20H30/c1-7-18(4)12-9-14-20(6)16-10-15-19(5)13-8-11-17(2)3/h7,9-12,14-16H,8,13H2,1-6H3 |
| InChIKey | AGITVXJLAYAIDJ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|