C20H30O2 — CID 170653107
(2E,4E,6E,10E)-7,11,15-trimethyl-3-(111C)methylhexadeca-2,4,6,10,14-pentaenoic acid (PubChem CID 170653107) has the molecular formula C20H30O2 and a molecular weight of 301.46 g/mol. Its IUPAC name is (2E,4E,6E,10E)-7,11,15-trimethyl-3-(111C)methylhexadeca-2,4,6,10,14-pentaenoic acid.
| Compound Name | (2E,4E,6E,10E)-7,11,15-trimethyl-3-(111C)methylhexadeca-2,4,6,10,14-pentaenoic acid |
|---|---|
| PubChem CID | 170653107 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | (2E,4E,6E,10E)-7,11,15-trimethyl-3-(111C)methylhexadeca-2,4,6,10,14-pentaenoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C=C/C([11CH3])=C/C(=O)O |
| InChI | InChI=1S/C20H30O2/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-19(5)15-20(21)22/h8-9,11,13-15H,6-7,10,12H2,1-5H3,(H,21,22)/b14-8+,17-11+,18-13+,19-15+/i5-1 |
| InChIKey | UUBHZHZSIKRVIV-FTZCBNFSSA-N |
| XLogP | 5.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|