C19H30O2 — CID 54454310
ethyl 5,9,13-trimethyltetradeca-2,4,8,12-tetraenoate (PubChem CID 54454310) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is ethyl 5,9,13-trimethyltetradeca-2,4,8,12-tetraenoate.
| Compound Name | ethyl 5,9,13-trimethyltetradeca-2,4,8,12-tetraenoate |
|---|---|
| PubChem CID | 54454310 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | ethyl 5,9,13-trimethyltetradeca-2,4,8,12-tetraenoate |
| SMILES | CCOC(=O)C=CC=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C19H30O2/c1-6-21-19(20)15-9-14-18(5)13-8-12-17(4)11-7-10-16(2)3/h9-10,12,14-15H,6-8,11,13H2,1-5H3 |
| InChIKey | WXCIIDBUNPXVPR-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|