C42H68O2 — CID 57102795
ethyl 3,7,11,15,19,23,27,31-octamethyldotriaconta-2,6,10,14,18,22,26,30-octaenoate (PubChem CID 57102795) has the molecular formula C42H68O2 and a molecular weight of 605.00 g/mol. Its IUPAC name is ethyl 3,7,11,15,19,23,27,31-octamethyldotriaconta-2,6,10,14,18,22,26,30-octaenoate.
| Compound Name | ethyl 3,7,11,15,19,23,27,31-octamethyldotriaconta-2,6,10,14,18,22,26,30-octaenoate |
|---|---|
| PubChem CID | 57102795 |
| Molecular Formula | C42H68O2 |
| Molecular Weight | 605.00 g/mol |
| Exact Mass | 604.52 |
| IUPAC Name | ethyl 3,7,11,15,19,23,27,31-octamethyldotriaconta-2,6,10,14,18,22,26,30-octaenoate |
| SMILES | CCOC(=O)C=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C42H68O2/c1-11-44-42(43)33-41(10)32-18-31-40(9)30-17-29-39(8)28-16-27-38(7)26-15-25-37(6)24-14-23-36(5)22-13-21-35(4)20-12-19-34(2)3/h19,21,23,25,27,29,31,33H,11-18,20,22,24,26,28,30,32H2,1-10H3 |
| InChIKey | KYFHUTDHJBYJTN-UHFFFAOYSA-N |
| XLogP | 13.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.00 |
| LogP ≤ 5 | 13.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|