C15H24O2 — CID 10847442
ethyl (2E,5E)-6,10-dimethylundeca-2,5,9-trienoate (PubChem CID 10847442) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is ethyl (2E,5E)-6,10-dimethylundeca-2,5,9-trienoate.
| Compound Name | ethyl (2E,5E)-6,10-dimethylundeca-2,5,9-trienoate |
|---|---|
| PubChem CID | 10847442 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | ethyl (2E,5E)-6,10-dimethylundeca-2,5,9-trienoate |
| SMILES | CCOC(=O)/C=C/C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C15H24O2/c1-5-17-15(16)12-7-6-10-14(4)11-8-9-13(2)3/h7,9-10,12H,5-6,8,11H2,1-4H3/b12-7+,14-10+ |
| InChIKey | XICQPIQPEJHOOI-QUULJSPLSA-N |
| XLogP | 4.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|