C18H30O3 — CID 71815721
ethyl (6E)-2,2,7,11-tetramethyl-3-oxododeca-6,10-dienoate (PubChem CID 71815721) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is ethyl (6E)-2,2,7,11-tetramethyl-3-oxododeca-6,10-dienoate.
| Compound Name | ethyl (6E)-2,2,7,11-tetramethyl-3-oxododeca-6,10-dienoate |
|---|---|
| PubChem CID | 71815721 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | ethyl (6E)-2,2,7,11-tetramethyl-3-oxododeca-6,10-dienoate |
| SMILES | CCOC(=O)C(C)(C)C(=O)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C18H30O3/c1-7-21-17(20)18(5,6)16(19)13-9-12-15(4)11-8-10-14(2)3/h10,12H,7-9,11,13H2,1-6H3/b15-12+ |
| InChIKey | OJCGJOLBSOPPIQ-NTCAYCPXSA-N |
| XLogP | 4.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|