C38H65O4P — CID 123158651
ethyl 2-diethoxyphosphanyl-5,9,13-trimethyl-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)tetradeca-4,8,12-trienoate (PubChem CID 123158651) has the molecular formula C38H65O4P and a molecular weight of 616.91 g/mol. Its IUPAC name is ethyl 2-diethoxyphosphanyl-5,9,13-trimethyl-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)tetradeca-4,8,12-trienoate.
| Compound Name | ethyl 2-diethoxyphosphanyl-5,9,13-trimethyl-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)tetradeca-4,8,12-trienoate |
|---|---|
| PubChem CID | 123158651 |
| Molecular Formula | C38H65O4P |
| Molecular Weight | 616.91 g/mol |
| Exact Mass | 616.46 |
| IUPAC Name | ethyl 2-diethoxyphosphanyl-5,9,13-trimethyl-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)tetradeca-4,8,12-trienoate |
| SMILES | CCOC(=O)C(CC=C(C)CCC=C(C)CCC=C(C)C)(CC=C(C)CCC=C(C)CCC=C(C)C)P(OCC)OCC |
| InChI | InChI=1S/C38H65O4P/c1-12-40-37(39)38(43(41-13-2)42-14-3,29-27-35(10)25-17-23-33(8)21-15-19-31(4)5)30-28-36(11)26-18-24-34(9)22-16-20-32(6)7/h19-20,23-24,27-28H,12-18,21-22,25-26,29-30H2,1-11H3 |
| InChIKey | VPIZCDMWSKVCMA-UHFFFAOYSA-N |
| XLogP | 12.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.91 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|