C22H38O — CID 175768643
(2Z,6E,10E)-2-ethoxy-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraene (PubChem CID 175768643) has the molecular formula C22H38O and a molecular weight of 318.55 g/mol. Its IUPAC name is (2Z,6E,10E)-2-ethoxy-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraene.
| Compound Name | (2Z,6E,10E)-2-ethoxy-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraene |
|---|---|
| PubChem CID | 175768643 |
| Molecular Formula | C22H38O |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.29 |
| IUPAC Name | (2Z,6E,10E)-2-ethoxy-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraene |
| SMILES | CCO/C(C)=C(/C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C22H38O/c1-8-23-22(7)21(6)17-11-16-20(5)15-10-14-19(4)13-9-12-18(2)3/h12,14,16H,8-11,13,15,17H2,1-7H3/b19-14+,20-16+,22-21- |
| InChIKey | VPFUBJOTOMIMOR-QEKFHWPGSA-N |
| XLogP | 7.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|