C22H35ClO2 — CID 168749422
ethyl (2Z,6E,10E)-2-chloro-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoate (PubChem CID 168749422) has the molecular formula C22H35ClO2 and a molecular weight of 366.97 g/mol. Its IUPAC name is ethyl (2Z,6E,10E)-2-chloro-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoate.
| Compound Name | ethyl (2Z,6E,10E)-2-chloro-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoate |
|---|---|
| PubChem CID | 168749422 |
| Molecular Formula | C22H35ClO2 |
| Molecular Weight | 366.97 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | ethyl (2Z,6E,10E)-2-chloro-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoate |
| SMILES | CCOC(=O)/C(Cl)=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C22H35ClO2/c1-7-25-22(24)21(23)20(6)16-10-15-19(5)14-9-13-18(4)12-8-11-17(2)3/h11,13,15H,7-10,12,14,16H2,1-6H3/b18-13+,19-15+,21-20- |
| InChIKey | HEXXGEKXIYVVBI-XTDLFZEMSA-N |
| XLogP | 7.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.97 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|