C28H46O2 — CID 88897643
ethyl (2E,6E,10E,14E)-2,3,7,11,15,19-hexamethylicosa-2,6,10,14,18-pentaenoate (PubChem CID 88897643) has the molecular formula C28H46O2 and a molecular weight of 414.67 g/mol. Its IUPAC name is ethyl (2E,6E,10E,14E)-2,3,7,11,15,19-hexamethylicosa-2,6,10,14,18-pentaenoate.
| Compound Name | ethyl (2E,6E,10E,14E)-2,3,7,11,15,19-hexamethylicosa-2,6,10,14,18-pentaenoate |
|---|---|
| PubChem CID | 88897643 |
| Molecular Formula | C28H46O2 |
| Molecular Weight | 414.67 g/mol |
| Exact Mass | 414.35 |
| IUPAC Name | ethyl (2E,6E,10E,14E)-2,3,7,11,15,19-hexamethylicosa-2,6,10,14,18-pentaenoate |
| SMILES | CCOC(=O)/C(C)=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C28H46O2/c1-9-30-28(29)27(8)26(7)21-13-20-25(6)19-12-18-24(5)17-11-16-23(4)15-10-14-22(2)3/h14,16,18,20H,9-13,15,17,19,21H2,1-8H3/b23-16+,24-18+,25-20+,27-26+ |
| InChIKey | FQLBBGVYNXRRFJ-ISHUZPSVSA-N |
| XLogP | 8.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.67 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|