C29H49NO2 — CID 53467733
ethyl N-[(3E,7E,11E,15E)-3,7,12,16,20-pentamethylhenicosa-3,7,11,15,19-pentaenyl]carbamate (PubChem CID 53467733) has the molecular formula C29H49NO2 and a molecular weight of 443.72 g/mol. Its IUPAC name is ethyl N-[(3E,7E,11E,15E)-3,7,12,16,20-pentamethylhenicosa-3,7,11,15,19-pentaenyl]carbamate.
| Compound Name | ethyl N-[(3E,7E,11E,15E)-3,7,12,16,20-pentamethylhenicosa-3,7,11,15,19-pentaenyl]carbamate |
|---|---|
| PubChem CID | 53467733 |
| Molecular Formula | C29H49NO2 |
| Molecular Weight | 443.72 g/mol |
| Exact Mass | 443.38 |
| IUPAC Name | ethyl N-[(3E,7E,11E,15E)-3,7,12,16,20-pentamethylhenicosa-3,7,11,15,19-pentaenyl]carbamate |
| SMILES | CCOC(=O)NCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C29H49NO2/c1-8-32-29(31)30-23-22-28(7)21-13-19-26(5)16-10-9-15-25(4)18-12-20-27(6)17-11-14-24(2)3/h14-16,20-21H,8-13,17-19,22-23H2,1-7H3,(H,30,31)/b25-15+,26-16+,27-20+,28-21+ |
| InChIKey | JKDAHAGBTAJIFK-BANQPHDMSA-N |
| XLogP | 8.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.72 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|