C25H47NO5Si — CID 72645189
4,8,12-trimethyltrideca-3,7,11-trienyl N-[3-[diethoxy(methoxy)silyl]propyl]carbamate (PubChem CID 72645189) has the molecular formula C25H47NO5Si and a molecular weight of 469.74 g/mol. Its IUPAC name is 4,8,12-trimethyltrideca-3,7,11-trienyl N-[3-[diethoxy(methoxy)silyl]propyl]carbamate.
| Compound Name | 4,8,12-trimethyltrideca-3,7,11-trienyl N-[3-[diethoxy(methoxy)silyl]propyl]carbamate |
|---|---|
| PubChem CID | 72645189 |
| Molecular Formula | C25H47NO5Si |
| Molecular Weight | 469.74 g/mol |
| Exact Mass | 469.32 |
| IUPAC Name | 4,8,12-trimethyltrideca-3,7,11-trienyl N-[3-[diethoxy(methoxy)silyl]propyl]carbamate |
| SMILES | CCO[Si](CCCNC(=O)OCCC=C(C)CCC=C(C)CCC=C(C)C)(OC)OCC |
| InChI | InChI=1S/C25H47NO5Si/c1-8-30-32(28-7,31-9-2)21-13-19-26-25(27)29-20-12-18-24(6)17-11-16-23(5)15-10-14-22(3)4/h14,16,18H,8-13,15,17,19-21H2,1-7H3,(H,26,27) |
| InChIKey | JSGAAVPMKGSKKI-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.74 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|