C22H48N2O9Si2 — CID 123219063
[3-oxo-3-(3-triethoxysilylpropylamino)propyl] N-(3-triethoxysilylpropyl)carbamate (PubChem CID 123219063) has the molecular formula C22H48N2O9Si2 and a molecular weight of 540.80 g/mol. Its IUPAC name is [3-oxo-3-(3-triethoxysilylpropylamino)propyl] N-(3-triethoxysilylpropyl)carbamate.
| Compound Name | [3-oxo-3-(3-triethoxysilylpropylamino)propyl] N-(3-triethoxysilylpropyl)carbamate |
|---|---|
| PubChem CID | 123219063 |
| Molecular Formula | C22H48N2O9Si2 |
| Molecular Weight | 540.80 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | [3-oxo-3-(3-triethoxysilylpropylamino)propyl] N-(3-triethoxysilylpropyl)carbamate |
| SMILES | CCO[Si](CCCNC(=O)CCOC(=O)NCCC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C22H48N2O9Si2/c1-7-28-34(29-8-2,30-9-3)19-13-16-23-21(25)15-18-27-22(26)24-17-14-20-35(31-10-4,32-11-5)33-12-6/h7-20H2,1-6H3,(H,23,25)(H,24,26) |
| InChIKey | CIYLHLIWUJNWMQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 122.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.80 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|