C16H33NO7Si — CID 58205270
6-(3-triethoxysilylpropylcarbamoyloxy)hexanoic acid (PubChem CID 58205270) has the molecular formula C16H33NO7Si and a molecular weight of 379.53 g/mol. Its IUPAC name is 6-(3-triethoxysilylpropylcarbamoyloxy)hexanoic acid.
| Compound Name | 6-(3-triethoxysilylpropylcarbamoyloxy)hexanoic acid |
|---|---|
| PubChem CID | 58205270 |
| Molecular Formula | C16H33NO7Si |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 6-(3-triethoxysilylpropylcarbamoyloxy)hexanoic acid |
| SMILES | CCO[Si](CCCNC(=O)OCCCCCC(=O)O)(OCC)OCC |
| InChI | InChI=1S/C16H33NO7Si/c1-4-22-25(23-5-2,24-6-3)14-10-12-17-16(20)21-13-9-7-8-11-15(18)19/h4-14H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | PFQUQDCYZJGZHO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|