About but-3-ynyl N-(3-triethoxysilylpropyl)carbamate
but-3-ynyl N-(3-triethoxysilylpropyl)carbamate (PubChem CID 71441394) has the molecular formula C14H27NO5Si
and a molecular weight of 317.46 g/mol. Its IUPAC name is but-3-ynyl N-(3-triethoxysilylpropyl)carbamate.
Molecular Properties
| Compound Name | but-3-ynyl N-(3-triethoxysilylpropyl)carbamate |
| PubChem CID | 71441394 |
| Molecular Formula | C14H27NO5Si |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | but-3-ynyl N-(3-triethoxysilylpropyl)carbamate |
| SMILES | C#CCCOC(=O)NCCC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C14H27NO5Si/c1-5-9-12-17-14(16)15-11-10-13-21(18-6-2,19-7-3)20-8-4/h1H,6-13H2,2-4H3,(H,15,16) |
| InChIKey | UFWDOUCLYKCBBC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-3-ynyl N-(3-triethoxysilylpropyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-ynyl N-(3-triethoxysilylpropyl)carbamate?
The IUPAC name of but-3-ynyl N-(3-triethoxysilylpropyl)carbamate (CID 71441394) is but-3-ynyl N-(3-triethoxysilylpropyl)carbamate.
What is the SMILES notation for but-3-ynyl N-(3-triethoxysilylpropyl)carbamate?
The canonical SMILES for but-3-ynyl N-(3-triethoxysilylpropyl)carbamate is C#CCCOC(=O)NCCC[Si](OCC)(OCC)OCC.
What is the InChIKey of but-3-ynyl N-(3-triethoxysilylpropyl)carbamate?
The InChIKey is UFWDOUCLYKCBBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO5Si/c1-5-9-12-17-14(16)15-11-10-13-21(18-6-2,19-7-3)20-8-4/h1H,6-13H2,2-4H3,(H,15,16).
What are the key properties of but-3-ynyl N-(3-triethoxysilylpropyl)carbamate?
but-3-ynyl N-(3-triethoxysilylpropyl)carbamate has a molecular weight of 317.46 g/mol, XLogP of 2.17, 12 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-ynyl N-(3-triethoxysilylpropyl)carbamate is sourced from PubChem (CID 71441394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).