C11H26N2O4Si — CID 59561209
2-amino-N-(3-triethoxysilylpropyl)acetamide (PubChem CID 59561209) has the molecular formula C11H26N2O4Si and a molecular weight of 278.42 g/mol. Its IUPAC name is 2-amino-N-(3-triethoxysilylpropyl)acetamide.
| Compound Name | 2-amino-N-(3-triethoxysilylpropyl)acetamide |
|---|---|
| PubChem CID | 59561209 |
| Molecular Formula | C11H26N2O4Si |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 2-amino-N-(3-triethoxysilylpropyl)acetamide |
| SMILES | CCO[Si](CCCNC(=O)CN)(OCC)OCC |
| InChI | InChI=1S/C11H26N2O4Si/c1-4-15-18(16-5-2,17-6-3)9-7-8-13-11(14)10-12/h4-10,12H2,1-3H3,(H,13,14) |
| InChIKey | NHIUITBLRQDHNL-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|