C20H43NO9Si — CID 71617959
2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-N-(3-triethoxysilylpropyl)acetamide (PubChem CID 71617959) has the molecular formula C20H43NO9Si and a molecular weight of 469.65 g/mol. Its IUPAC name is 2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-N-(3-triethoxysilylpropyl)acetamide.
| Compound Name | 2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-N-(3-triethoxysilylpropyl)acetamide |
|---|---|
| PubChem CID | 71617959 |
| Molecular Formula | C20H43NO9Si |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | 2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-N-(3-triethoxysilylpropyl)acetamide |
| SMILES | CCO[Si](CCCNC(=O)COCCOCCOCCOCCOC)(OCC)OCC |
| InChI | InChI=1S/C20H43NO9Si/c1-5-28-31(29-6-2,30-7-3)18-8-9-21-20(22)19-27-17-16-26-15-14-25-13-12-24-11-10-23-4/h5-19H2,1-4H3,(H,21,22) |
| InChIKey | CKNQBVWVTGFJPI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|