C26H60N2O11Si2 — CID 90926612
2-[2-(2,2-dimethoxyethoxy)ethoxy]-N-(3-triethoxysilylpropyl)acetamide;3-triethoxysilylpropan-1-amine (PubChem CID 90926612) has the molecular formula C26H60N2O11Si2 and a molecular weight of 632.94 g/mol. Its IUPAC name is 2-[2-(2,2-dimethoxyethoxy)ethoxy]-N-(3-triethoxysilylpropyl)acetamide;3-triethoxysilylpropan-1-amine.
| Compound Name | 2-[2-(2,2-dimethoxyethoxy)ethoxy]-N-(3-triethoxysilylpropyl)acetamide;3-triethoxysilylpropan-1-amine |
|---|---|
| PubChem CID | 90926612 |
| Molecular Formula | C26H60N2O11Si2 |
| Molecular Weight | 632.94 g/mol |
| Exact Mass | 632.37 |
| IUPAC Name | 2-[2-(2,2-dimethoxyethoxy)ethoxy]-N-(3-triethoxysilylpropyl)acetamide;3-triethoxysilylpropan-1-amine |
| SMILES | CCO[Si](CCCN)(OCC)OCC.CCO[Si](CCCNC(=O)COCCOCC(OC)OC)(OCC)OCC |
| InChI | InChI=1S/C17H37NO8Si.C9H23NO3Si/c1-6-24-27(25-7-2,26-8-3)13-9-10-18-16(19)14-22-11-12-23-15-17(20-4)21-5;1-4-11-14(12-5-2,13-6-3)9-7-8-10/h17H,6-15H2,1-5H3,(H,18,19);4-10H2,1-3H3 |
| InChIKey | IPLMORTUQZFMTN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 147.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.94 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|