C10H22N2O4 — CID 79473525
2-(2-aminoethoxy)-N-[3-(2-methoxyethoxy)propyl]acetamide (PubChem CID 79473525) has the molecular formula C10H22N2O4 and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-N-[3-(2-methoxyethoxy)propyl]acetamide.
| Compound Name | 2-(2-aminoethoxy)-N-[3-(2-methoxyethoxy)propyl]acetamide |
|---|---|
| PubChem CID | 79473525 |
| Molecular Formula | C10H22N2O4 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 2-(2-aminoethoxy)-N-[3-(2-methoxyethoxy)propyl]acetamide |
| SMILES | COCCOCCCNC(=O)COCCN |
| InChI | InChI=1S/C10H22N2O4/c1-14-7-8-15-5-2-4-12-10(13)9-16-6-3-11/h2-9,11H2,1H3,(H,12,13) |
| InChIKey | ZVVDNFPQRZGDLY-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|