C10H21N3O4 — CID 61274452
2-amino-N-[2-[3-(2-methoxyethoxy)propylamino]-2-oxoethyl]acetamide (PubChem CID 61274452) has the molecular formula C10H21N3O4 and a molecular weight of 247.29 g/mol. Its IUPAC name is 2-amino-N-[2-[3-(2-methoxyethoxy)propylamino]-2-oxoethyl]acetamide.
| Compound Name | 2-amino-N-[2-[3-(2-methoxyethoxy)propylamino]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 61274452 |
| Molecular Formula | C10H21N3O4 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 2-amino-N-[2-[3-(2-methoxyethoxy)propylamino]-2-oxoethyl]acetamide |
| SMILES | COCCOCCCNC(=O)CNC(=O)CN |
| InChI | InChI=1S/C10H21N3O4/c1-16-5-6-17-4-2-3-12-10(15)8-13-9(14)7-11/h2-8,11H2,1H3,(H,12,15)(H,13,14) |
| InChIKey | CMDQDHVCNMIHFL-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|