C8H17N3O3 — CID 60846761
2-amino-N-[2-(2-ethoxyethylamino)-2-oxoethyl]acetamide (PubChem CID 60846761) has the molecular formula C8H17N3O3 and a molecular weight of 203.24 g/mol. Its IUPAC name is 2-amino-N-[2-(2-ethoxyethylamino)-2-oxoethyl]acetamide.
| Compound Name | 2-amino-N-[2-(2-ethoxyethylamino)-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 60846761 |
| Molecular Formula | C8H17N3O3 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 2-amino-N-[2-(2-ethoxyethylamino)-2-oxoethyl]acetamide |
| SMILES | CCOCCNC(=O)CNC(=O)CN |
| InChI | InChI=1S/C8H17N3O3/c1-2-14-4-3-10-8(13)6-11-7(12)5-9/h2-6,9H2,1H3,(H,10,13)(H,11,12) |
| InChIKey | PUCIGKGYVAUSCU-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|