C10H22N4O3 — CID 146319756
N-[2-[2-[[2-(aminomethylamino)-2-oxoethyl]amino]ethoxy]ethyl]propanamide (PubChem CID 146319756) has the molecular formula C10H22N4O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is N-[2-[2-[[2-(aminomethylamino)-2-oxoethyl]amino]ethoxy]ethyl]propanamide.
| Compound Name | N-[2-[2-[[2-(aminomethylamino)-2-oxoethyl]amino]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 146319756 |
| Molecular Formula | C10H22N4O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | N-[2-[2-[[2-(aminomethylamino)-2-oxoethyl]amino]ethoxy]ethyl]propanamide |
| SMILES | CCC(=O)NCCOCCNCC(=O)NCN |
| InChI | InChI=1S/C10H22N4O3/c1-2-9(15)13-4-6-17-5-3-12-7-10(16)14-8-11/h12H,2-8,11H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | UZYIFCJJGCMPCK-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|