C8H17N3O4 — CID 61274286
2-amino-N-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]acetamide (PubChem CID 61274286) has the molecular formula C8H17N3O4 and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-amino-N-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]acetamide.
| Compound Name | 2-amino-N-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 61274286 |
| Molecular Formula | C8H17N3O4 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 2-amino-N-[2-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethyl]acetamide |
| SMILES | NCC(=O)NCC(=O)NCCOCCO |
| InChI | InChI=1S/C8H17N3O4/c9-5-7(13)11-6-8(14)10-1-3-15-4-2-12/h12H,1-6,9H2,(H,10,14)(H,11,13) |
| InChIKey | WUCQYWYKAGFHDT-UHFFFAOYSA-N |
| XLogP | -2.81 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|