C7H15N5O3 — CID 83111303
2-amino-N-[2-[2-(carbamoylamino)ethylamino]-2-oxoethyl]acetamide (PubChem CID 83111303) has the molecular formula C7H15N5O3 and a molecular weight of 217.23 g/mol. Its IUPAC name is 2-amino-N-[2-[2-(carbamoylamino)ethylamino]-2-oxoethyl]acetamide.
| Compound Name | 2-amino-N-[2-[2-(carbamoylamino)ethylamino]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 83111303 |
| Molecular Formula | C7H15N5O3 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 2-amino-N-[2-[2-(carbamoylamino)ethylamino]-2-oxoethyl]acetamide |
| SMILES | NCC(=O)NCC(=O)NCCNC(N)=O |
| InChI | InChI=1S/C7H15N5O3/c8-3-5(13)12-4-6(14)10-1-2-11-7(9)15/h1-4,8H2,(H,10,14)(H,12,13)(H3,9,11,15) |
| InChIKey | SJHHQYURINOFCU-UHFFFAOYSA-N |
| XLogP | -3.15 |
| TPSA | 139.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|