C8H18N4O4S — CID 114175259
2-amino-N-[2-[2-(dimethylsulfamoyl)ethylamino]-2-oxoethyl]acetamide (PubChem CID 114175259) has the molecular formula C8H18N4O4S and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-amino-N-[2-[2-(dimethylsulfamoyl)ethylamino]-2-oxoethyl]acetamide.
| Compound Name | 2-amino-N-[2-[2-(dimethylsulfamoyl)ethylamino]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 114175259 |
| Molecular Formula | C8H18N4O4S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 2-amino-N-[2-[2-(dimethylsulfamoyl)ethylamino]-2-oxoethyl]acetamide |
| SMILES | CN(C)S(=O)(=O)CCNC(=O)CNC(=O)CN |
| InChI | InChI=1S/C8H18N4O4S/c1-12(2)17(15,16)4-3-10-8(14)6-11-7(13)5-9/h3-6,9H2,1-2H3,(H,10,14)(H,11,13) |
| InChIKey | HOAFDFRQOXAHJF-UHFFFAOYSA-N |
| XLogP | -2.93 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | -2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |