C8H19N3O3S — CID 106335770
1-[2-(dimethylsulfamoyl)ethyl]-3-propylurea (PubChem CID 106335770) has the molecular formula C8H19N3O3S and a molecular weight of 237.32 g/mol. Its IUPAC name is 1-[2-(dimethylsulfamoyl)ethyl]-3-propylurea.
| Compound Name | 1-[2-(dimethylsulfamoyl)ethyl]-3-propylurea |
|---|---|
| PubChem CID | 106335770 |
| Molecular Formula | C8H19N3O3S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 1-[2-(dimethylsulfamoyl)ethyl]-3-propylurea |
| SMILES | CCCNC(=O)NCCS(=O)(=O)N(C)C |
| InChI | InChI=1S/C8H19N3O3S/c1-4-5-9-8(12)10-6-7-15(13,14)11(2)3/h4-7H2,1-3H3,(H2,9,10,12) |
| InChIKey | ODRVBTBFYKBJCY-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |