C11H23N3O5S — CID 106341239
2-[[2-(dimethylsulfamoyl)ethylcarbamoylamino]methyl]-3-methylbutanoic acid (PubChem CID 106341239) has the molecular formula C11H23N3O5S and a molecular weight of 309.39 g/mol. Its IUPAC name is 2-[[2-(dimethylsulfamoyl)ethylcarbamoylamino]methyl]-3-methylbutanoic acid.
| Compound Name | 2-[[2-(dimethylsulfamoyl)ethylcarbamoylamino]methyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 106341239 |
| Molecular Formula | C11H23N3O5S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 2-[[2-(dimethylsulfamoyl)ethylcarbamoylamino]methyl]-3-methylbutanoic acid |
| SMILES | CC(C)C(CNC(=O)NCCS(=O)(=O)N(C)C)C(=O)O |
| InChI | InChI=1S/C11H23N3O5S/c1-8(2)9(10(15)16)7-13-11(17)12-5-6-20(18,19)14(3)4/h8-9H,5-7H2,1-4H3,(H,15,16)(H2,12,13,17) |
| InChIKey | KUEBWBLSWPOVII-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |