C9H19BrN2O3S — CID 106335483
2-bromo-N-[2-(dimethylsulfamoyl)ethyl]-3-methylbutanamide (PubChem CID 106335483) has the molecular formula C9H19BrN2O3S and a molecular weight of 315.23 g/mol. Its IUPAC name is 2-bromo-N-[2-(dimethylsulfamoyl)ethyl]-3-methylbutanamide.
| Compound Name | 2-bromo-N-[2-(dimethylsulfamoyl)ethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 106335483 |
| Molecular Formula | C9H19BrN2O3S |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 2-bromo-N-[2-(dimethylsulfamoyl)ethyl]-3-methylbutanamide |
| SMILES | CC(C)C(Br)C(=O)NCCS(=O)(=O)N(C)C |
| InChI | InChI=1S/C9H19BrN2O3S/c1-7(2)8(10)9(13)11-5-6-16(14,15)12(3)4/h7-8H,5-6H2,1-4H3,(H,11,13) |
| InChIKey | LGYAYDNMHOZJFU-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|