C9H19N3O3S2 — CID 106338828
2-carbamothioyl-N-[2-(dimethylsulfamoyl)ethyl]butanamide (PubChem CID 106338828) has the molecular formula C9H19N3O3S2 and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-carbamothioyl-N-[2-(dimethylsulfamoyl)ethyl]butanamide.
| Compound Name | 2-carbamothioyl-N-[2-(dimethylsulfamoyl)ethyl]butanamide |
|---|---|
| PubChem CID | 106338828 |
| Molecular Formula | C9H19N3O3S2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2-carbamothioyl-N-[2-(dimethylsulfamoyl)ethyl]butanamide |
| SMILES | CCC(C(=O)NCCS(=O)(=O)N(C)C)C(N)=S |
| InChI | InChI=1S/C9H19N3O3S2/c1-4-7(8(10)16)9(13)11-5-6-17(14,15)12(2)3/h7H,4-6H2,1-3H3,(H2,10,16)(H,11,13) |
| InChIKey | ZDDKPXDLDCJAIT-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|